Products 2454490-81-2
CAS 2454490-81-2 is the registry number for tert-Butyl (1S,5S)-2,6-diazabicyclo[3.2.0]heptane-6-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (1S,5S)-2,6-diazabicyclo[3.2.0]heptane-6-carboxylate (CAS 2454490-81-2) is a chemical compound with the molecular formula C10H18N2O2 and a molecular weight of 198.26 g/mol. IUPAC name: tert-butyl (1S,5S)-2,6-diazabicyclo[3.2.0]heptane-6-carboxylate. InChIKey: BDVMAANWMDTLFP-YUMQZZPRSA-N.
| Molecular formula | C10H18N2O2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | tert-butyl (1S,5S)-2,6-diazabicyclo[3.2.0]heptane-6-carboxylate |
| InChIKey | BDVMAANWMDTLFP-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2[C@@H]1CCN2 |
Computed by PubChem (NCBI)