CAS 1408705-83-8 appears in our catalog under these names: 1-((4-Chlorophenyl)methyl)-3-(furan-2-yl)-1H-pyrazol-5-amine, 95%, 1-((4-Chlorophenyl)methyl)-3-(furan-2-yl)-1H-pyrazol-5-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[(4-chlorophenyl)methyl]-3-(furan-2-yl)pyrazol-5-amine (CAS 1408705-83-8) is a chemical compound with the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-3-(furan-2-yl)pyrazol-5-amine. InChIKey: DMKCDEXMCIGNKY-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3O |
|---|---|
| Molecular weight | 273.72 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-3-(furan-2-yl)pyrazol-5-amine |
| InChIKey | DMKCDEXMCIGNKY-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NN(C(=C2)N)CC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)