CAS 879457-80-4 is the registry number for 6-Chloro-2,5-dimethyl-3-phenylpyrazolo(1,5-a)pyrimidin-7-ol, 97%. Offered by: AmBeed. Available pack sizes: 1g.
6-chloro-2,5-dimethyl-3-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one (CAS 879457-80-4) is a chemical compound with the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. IUPAC name: 6-chloro-2,5-dimethyl-3-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one. InChIKey: AOKGMYFPEKZWSQ-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3O |
|---|---|
| Molecular weight | 273.72 g/mol |
| IUPAC name | 6-chloro-2,5-dimethyl-3-phenyl-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| InChIKey | AOKGMYFPEKZWSQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=NC(=C(C(=O)N2N1)Cl)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)