Products 27610-14-6

CAS 27610-14-6 is the registry number for Estazolam Impurity 4. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

3-amino-6-chloro-4-phenylquinazolin-4-ol (CAS 27610-14-6) is a chemical compound with the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. IUPAC name: 3-amino-6-chloro-4-phenylquinazolin-4-ol. InChIKey: ZAXFFQSOWYVGER-UHFFFAOYSA-N.

Identity
Molecular formulaC14H12ClN3O
Molecular weight273.72 g/mol
IUPAC name3-amino-6-chloro-4-phenylquinazolin-4-ol
InChIKeyZAXFFQSOWYVGER-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2(C3=C(C=CC(=C3)Cl)N=CN2N)O

Computed by PubChem (NCBI)