CAS 19680-35-4 appears in our catalog under these names: 2-Chloro-n-(4-phenylazo-phenyl)-acetamide, 95%, 2-Chloro-N-(4-(2-phenyldiazen-1-yl)phenyl)acetamide, 95%, 2-Chloro-N-(4-(2-phenyldiazen-1-yl)phenyl)acetamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 2,5g.
2-chloro-N-(4-phenyldiazenylphenyl)acetamide (CAS 19680-35-4) is a chemical compound with the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. IUPAC name: 2-chloro-N-(4-phenyldiazenylphenyl)acetamide. InChIKey: GZRJHDPHDCWZFA-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3O |
|---|---|
| Molecular weight | 273.72 g/mol |
| IUPAC name | 2-chloro-N-(4-phenyldiazenylphenyl)acetamide |
| InChIKey | GZRJHDPHDCWZFA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)NC(=O)CCl |
Computed by PubChem (NCBI)