CAS 1408975-33-6 appears in our catalog under these names: 3-Bromo-1-((2,4-difluorophenyl)methyl)piperidin-2-one, 95%, 3-Bromo-1-((2,4-difluorophenyl)methyl)piperidin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one (CAS 1408975-33-6) is a chemical compound with the molecular formula C12H12BrF2NO and a molecular weight of 304.13 g/mol. IUPAC name: 3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one. InChIKey: NJNXVDXLFSMGPK-UHFFFAOYSA-N.
| Molecular formula | C12H12BrF2NO |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | 3-bromo-1-[(2,4-difluorophenyl)methyl]piperidin-2-one |
| InChIKey | NJNXVDXLFSMGPK-UHFFFAOYSA-N |
| SMILES | C1CC(C(=O)N(C1)CC2=C(C=C(C=C2)F)F)Br |
Computed by PubChem (NCBI)