CAS 955406-30-1 is the registry number for (4-Bromophenyl)(4,4-difluoropiperidin-1-yl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4-bromophenyl)-(4,4-difluoropiperidin-1-yl)methanone (CAS 955406-30-1) is a chemical compound with the molecular formula C12H12BrF2NO and a molecular weight of 304.13 g/mol. IUPAC name: (4-bromophenyl)-(4,4-difluoropiperidin-1-yl)methanone. InChIKey: YCQQXJQRTUMDOM-UHFFFAOYSA-N.
| Molecular formula | C12H12BrF2NO |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | (4-bromophenyl)-(4,4-difluoropiperidin-1-yl)methanone |
| InChIKey | YCQQXJQRTUMDOM-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(F)F)C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)