Products 2918914-66-4
CAS 2918914-66-4 is the registry number for (3-bromo-2,6-difluorophenyl)(piperidin-1-yl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3-bromo-2,6-difluorophenyl)-piperidin-1-ylmethanone (CAS 2918914-66-4) is a chemical compound with the molecular formula C12H12BrF2NO and a molecular weight of 304.13 g/mol. IUPAC name: (3-bromo-2,6-difluorophenyl)-piperidin-1-ylmethanone. InChIKey: XBGFHECWYAYBRV-UHFFFAOYSA-N.
| Molecular formula | C12H12BrF2NO |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | (3-bromo-2,6-difluorophenyl)-piperidin-1-ylmethanone |
| InChIKey | XBGFHECWYAYBRV-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)C2=C(C=CC(=C2F)Br)F |
Computed by PubChem (NCBI)