CAS 1909319-79-4 is the registry number for 6-Bromo-3,4-difluoro-2-(piperidin-1-yl)benzaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-3,4-difluoro-2-piperidin-1-ylbenzaldehyde (CAS 1909319-79-4) is a chemical compound with the molecular formula C12H12BrF2NO and a molecular weight of 304.13 g/mol. IUPAC name: 6-bromo-3,4-difluoro-2-piperidin-1-ylbenzaldehyde. InChIKey: WSRYIQFBFYYSCN-UHFFFAOYSA-N.
| Molecular formula | C12H12BrF2NO |
|---|---|
| Molecular weight | 304.13 g/mol |
| IUPAC name | 6-bromo-3,4-difluoro-2-piperidin-1-ylbenzaldehyde |
| InChIKey | WSRYIQFBFYYSCN-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C(=CC(=C2C=O)Br)F)F |
Computed by PubChem (NCBI)