Products 140924-23-8
CAS 140924-23-8 appears in our catalog under these names: (2R,3S)–Chlorpheg, (2R,3S)-Chlorpheg. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, Get quote.
(2R,3R)-2-amino-3-(4-chlorophenyl)pentanedioic acid (CAS 140924-23-8) is a chemical compound with the molecular formula C11H12ClNO4 and a molecular weight of 257.67 g/mol. IUPAC name: (2R,3R)-2-amino-3-(4-chlorophenyl)pentanedioic acid. InChIKey: ZHXBCPSYEAQEHB-PSASIEDQSA-N.
| Molecular formula | C11H12ClNO4 |
|---|---|
| Molecular weight | 257.67 g/mol |
| IUPAC name | (2R,3R)-2-amino-3-(4-chlorophenyl)pentanedioic acid |
| InChIKey | ZHXBCPSYEAQEHB-PSASIEDQSA-N |
| SMILES | C1=CC(=CC=C1[C@@H](CC(=O)O)[C@H](C(=O)O)N)Cl |
Computed by PubChem (NCBI)