Products 1409694-14-9
CAS 1409694-14-9 is the registry number for 4-Bromo-N-(2-cyclopropyl-2-hydroxyethyl)benzamide, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
4-bromo-N-(2-cyclopropyl-2-hydroxyethyl)benzamide (CAS 1409694-14-9) is a chemical compound with the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. IUPAC name: 4-bromo-N-(2-cyclopropyl-2-hydroxyethyl)benzamide. InChIKey: SABXFIZRGWSSJK-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO2 |
|---|---|
| Molecular weight | 284.15 g/mol |
| IUPAC name | 4-bromo-N-(2-cyclopropyl-2-hydroxyethyl)benzamide |
| InChIKey | SABXFIZRGWSSJK-UHFFFAOYSA-N |
| SMILES | C1CC1C(CNC(=O)C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)