CAS 1409856-65-0 is the registry number for 1-(4-Chloro-1H-pyrrole-2-carbonyl)-3-methylpyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-chloro-1H-pyrrole-2-carbonyl)-3-methylpyrrolidine-3-carboxylic acid (CAS 1409856-65-0) is a chemical compound with the molecular formula C11H13ClN2O3 and a molecular weight of 256.68 g/mol. IUPAC name: 1-(4-chloro-1H-pyrrole-2-carbonyl)-3-methylpyrrolidine-3-carboxylic acid. InChIKey: LKXKXUNIWLWMHS-UHFFFAOYSA-N.
| Molecular formula | C11H13ClN2O3 |
|---|---|
| Molecular weight | 256.68 g/mol |
| IUPAC name | 1-(4-chloro-1H-pyrrole-2-carbonyl)-3-methylpyrrolidine-3-carboxylic acid |
| InChIKey | LKXKXUNIWLWMHS-UHFFFAOYSA-N |
| SMILES | CC1(CCN(C1)C(=O)C2=CC(=CN2)Cl)C(=O)O |
Computed by PubChem (NCBI)