CAS 141-24-2 appears in our catalog under these names: Ricinoleic acid-methyl ester, Ricinic Acid Methyl Ester, Ricinoleic Acid methyl ester, Methyl ricinoleate, Methyl Ricinoleate, >75.0%(GC). Offered by: Dr. Ehrenstorfer, TRC, GLPBio, Biosynth, TCI. Available pack sizes: 50mg, 100mg, 1g, 500mg, 25ml, 500ml, 2g, 5g.
Methyl (Z,12R)-12-hydroxyoctadec-9-enoate (CAS 141-24-2) is a chemical compound with the molecular formula C19H36O3 and a molecular weight of 312.5 g/mol. IUPAC name: methyl (Z,12R)-12-hydroxyoctadec-9-enoate. InChIKey: XKGDWZQXVZSXAO-ADYSOMBNSA-N.
| Molecular formula | C19H36O3 |
|---|---|
| Molecular weight | 312.5 g/mol |
| IUPAC name | methyl (Z,12R)-12-hydroxyoctadec-9-enoate |
| InChIKey | XKGDWZQXVZSXAO-ADYSOMBNSA-N |
| SMILES | CCCCCC[C@H](C/C=C\CCCCCCCC(=O)OC)O |
Computed by PubChem (NCBI)