Products 870-10-0
CAS 870-10-0 appears in our catalog under these names: Methyl 10-oxooctadecanoate, Methyl 10-oxooctadecanoate, 95%, Octadecanoic acid， 10–oxo–， methyl ester, Octadecanoic acid， 10-oxo-， methyl ester, 95%, 95%. Offered by: Biosynth, Combi-blocks, Fluorochem, GLPBio, Chemat. Available pack sizes: 25mg, 10mg, 50mg, 100mg, 250mg.
Methyl 10-oxooctadecanoate (CAS 870-10-0) is a chemical compound with the molecular formula C19H36O3 and a molecular weight of 312.5 g/mol. IUPAC name: methyl 10-oxooctadecanoate. InChIKey: YZQUPDATKHOMLU-UHFFFAOYSA-N.
| Molecular formula | C19H36O3 |
|---|---|
| Molecular weight | 312.5 g/mol |
| IUPAC name | methyl 10-oxooctadecanoate |
| InChIKey | YZQUPDATKHOMLU-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)CCCCCCCCC(=O)OC |
Computed by PubChem (NCBI)