CAS 1842-70-2 appears in our catalog under these names: Methyl 10-Oxooctadecanoate, methyl 10–oxooctadecanoate, Octadecanoic acid,9-oxo-, methyl ester, 95%, 95%, Methyl 9-oxooctadecanoate, Methyl 9-oxooctadecanoate, 95%. Offered by: TRC, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 750mg, 25mg, 5mg, 100mg, 250mg, 250 mg, 50 mg, 25 mg.
Methyl 9-oxooctadecanoate (CAS 1842-70-2) is a chemical compound with the molecular formula C19H36O3 and a molecular weight of 312.5 g/mol. IUPAC name: methyl 9-oxooctadecanoate. InChIKey: NNUFZSSGONRIJT-UHFFFAOYSA-N.
| Molecular formula | C19H36O3 |
|---|---|
| Molecular weight | 312.5 g/mol |
| IUPAC name | methyl 9-oxooctadecanoate |
| InChIKey | NNUFZSSGONRIJT-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)CCCCCCCC(=O)OC |
Computed by PubChem (NCBI)