Products 2500-59-6
CAS 2500-59-6 appears in our catalog under these names: 2-Oxiraneoctanoic acid,3-octyl-, methyl ester, 95%, methyl 9，10–epoxystearate, Methyl 8-(3-octyloxiran-2-yl)octanoate 95%, 2-OXIRANEOCTANOIC ACID,3-OCTYL-, METHYL ESTER, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg.
Methyl 8-(3-octyloxiran-2-yl)octanoate (CAS 2500-59-6) is a chemical compound with the molecular formula C19H36O3 and a molecular weight of 312.5 g/mol. IUPAC name: methyl 8-(3-octyloxiran-2-yl)octanoate. InChIKey: CAMHHLOGFDZBBG-UHFFFAOYSA-N.
| Molecular formula | C19H36O3 |
|---|---|
| Molecular weight | 312.5 g/mol |
| IUPAC name | methyl 8-(3-octyloxiran-2-yl)octanoate |
| InChIKey | CAMHHLOGFDZBBG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC1C(O1)CCCCCCCC(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Methyl 9,10-epoxyoctadecanoate, 2-Oxiraneoctanoic acid,3-octyl-, methyl ester, 2-Oxiraneoctanoic acid, 3-octyl-, methyl ester, 9,10-Epoxystearic acid methyl ester, 3-Octyloxiraneoctanoic acid methyl ester, (+/-)-trans-9,10-Epoxystearic Acid Methyl Ester, 3-Octyloxirane-2-octanoic acid methyl ester, Octadecanoic acid, 9,10-epoxy-, methyl ester, orb2893643, methyl 9,10-epoxy-octadecanoate