CAS 1410281-75-2 is the registry number for 3-Methyl-1-(4-methylthiazole-5-carbonyl)pyrrolidine-3-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-methyl-1-(4-methyl-1,3-thiazole-5-carbonyl)pyrrolidine-3-carboxylic acid (CAS 1410281-75-2) is a chemical compound with the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. IUPAC name: 3-methyl-1-(4-methyl-1,3-thiazole-5-carbonyl)pyrrolidine-3-carboxylic acid. InChIKey: AKMOZGAJJSCQNL-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3S |
|---|---|
| Molecular weight | 254.31 g/mol |
| IUPAC name | 3-methyl-1-(4-methyl-1,3-thiazole-5-carbonyl)pyrrolidine-3-carboxylic acid |
| InChIKey | AKMOZGAJJSCQNL-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C(=O)N2CCC(C2)(C)C(=O)O |
Computed by PubChem (NCBI)