Products 1410794-06-7
CAS 1410794-06-7 appears in our catalog under these names: Bisphenol F-13C6, >95% (HPLC), Bisphenol F-13C6, Bisphenol F-13C6, 98.32%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 50mg, 25mg, 1 mg.
4-[(4-hydroxyphenyl)methyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 1410794-06-7) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 206.19 g/mol. IUPAC name: 4-[(4-hydroxyphenyl)methyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: PXKLMJQFEQBVLD-UTHCEYBASA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 206.19 g/mol |
| IUPAC name | 4-[(4-hydroxyphenyl)methyl](1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | PXKLMJQFEQBVLD-UTHCEYBASA-N |
| SMILES | C1=CC(=CC=C1C[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)O)O |
Computed by PubChem (NCBI)