CAS 1411037-38-1 is the registry number for 7-Methyl-2-(2,4,6-trimethylphenyl)-3H-imidazo(4,5-b)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
7-methyl-2-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridine (CAS 1411037-38-1) is a chemical compound with the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. IUPAC name: 7-methyl-2-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridine. InChIKey: UMAIKCDPPGDREE-UHFFFAOYSA-N.
| Molecular formula | C16H17N3 |
|---|---|
| Molecular weight | 251.33 g/mol |
| IUPAC name | 7-methyl-2-(2,4,6-trimethylphenyl)-1H-imidazo[4,5-b]pyridine |
| InChIKey | UMAIKCDPPGDREE-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC=C1)N=C(N2)C3=C(C=C(C=C3C)C)C |
Computed by PubChem (NCBI)