Products 14115-49-2
CAS 14115-49-2 is the registry number for 4,4,4-trifluoro-3,3-bis(trifluoromethyl)butan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
4,4,4-trifluoro-3,3-bis(trifluoromethyl)butan-1-ol (CAS 14115-49-2) is a chemical compound with the molecular formula C6H5F9O and a molecular weight of 264.09 g/mol. IUPAC name: 4,4,4-trifluoro-3,3-bis(trifluoromethyl)butan-1-ol. InChIKey: BUPOXNIZANUQTQ-UHFFFAOYSA-N.
| Molecular formula | C6H5F9O |
|---|---|
| Molecular weight | 264.09 g/mol |
| IUPAC name | 4,4,4-trifluoro-3,3-bis(trifluoromethyl)butan-1-ol |
| InChIKey | BUPOXNIZANUQTQ-UHFFFAOYSA-N |
| SMILES | C(CO)C(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)