CAS 163702-06-5 is the registry number for 2-(Ethoxydifluoromethyl)-1,1,1,2,3,3,3-heptafluoropropane, 95%, 95%. Offered by: Chemat. Available pack sizes: 50g, 250g, 1kg, 100g, 500g.
1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane (CAS 163702-06-5) is a chemical compound with the molecular formula C6H5F9O and a molecular weight of 264.09 g/mol. IUPAC name: 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane. InChIKey: SQEGLLMNIBLLNQ-UHFFFAOYSA-N.
| Molecular formula | C6H5F9O |
|---|---|
| Molecular weight | 264.09 g/mol |
| IUPAC name | 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane |
| InChIKey | SQEGLLMNIBLLNQ-UHFFFAOYSA-N |
| SMILES | CCOC(C(C(F)(F)F)(C(F)(F)F)F)(F)F |
Computed by PubChem (NCBI)