Products 163702-06-5

CAS 163702-06-5 is the registry number for 2-(Ethoxydifluoromethyl)-1,1,1,2,3,3,3-heptafluoropropane, 95%, 95%. Offered by: Chemat. Available pack sizes: 50g, 250g, 1kg, 100g, 500g.

Structural formula: {0} (CAS {1})

1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane (CAS 163702-06-5) is a chemical compound with the molecular formula C6H5F9O and a molecular weight of 264.09 g/mol. IUPAC name: 1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane. InChIKey: SQEGLLMNIBLLNQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5F9O
Molecular weight264.09 g/mol
IUPAC name1-ethoxy-1,1,2,3,3,3-hexafluoro-2-(trifluoromethyl)propane
InChIKeySQEGLLMNIBLLNQ-UHFFFAOYSA-N
SMILESCCOC(C(C(F)(F)F)(C(F)(F)F)F)(F)F

Computed by PubChem (NCBI)