CAS 2043-47-2 appears in our catalog under these names: 1H,1H,2H,2H-Perfluorohexan-1-ol, 98%, 1H,1H,2H,2H-Perfluorohexanol, 1H,1H,2H,2H-Perfluoro-1-hexanol, 1H,1H,2H,2H–Perfluorohexan–1–ol, 1H,1H,2H,2H-Nonafluoro-1-hexanol, >97.0%(GC). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, TCI. Available pack sizes: 100g, 5g, 25g, 1g, 100mg, 25MG, 1x100mg, 10g.
3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol (CAS 2043-47-2) is a chemical compound with the molecular formula C6H5F9O and a molecular weight of 264.09 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol. InChIKey: JCMNMOBHVPONLD-UHFFFAOYSA-N.
| Molecular formula | C6H5F9O |
|---|---|
| Molecular weight | 264.09 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,6-nonafluorohexan-1-ol |
| InChIKey | JCMNMOBHVPONLD-UHFFFAOYSA-N |
| SMILES | C(CO)C(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)