CAS 163702-05-4 is the registry number for Butane, 1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluoro-, 99%. Offered by: Fluorochem. Available pack sizes: 5g.
1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane (CAS 163702-05-4) is a chemical compound with the molecular formula C6H5F9O and a molecular weight of 264.09 g/mol. IUPAC name: 1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane. InChIKey: DFUYAWQUODQGFF-UHFFFAOYSA-N.
| Molecular formula | C6H5F9O |
|---|---|
| Molecular weight | 264.09 g/mol |
| IUPAC name | 1-ethoxy-1,1,2,2,3,3,4,4,4-nonafluorobutane |
| InChIKey | DFUYAWQUODQGFF-UHFFFAOYSA-N |
| SMILES | CCOC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)