Products 1411614-11-3
CAS 1411614-11-3 is the registry number for 2-{((tert-Butoxy)carbonyl)amino}adamantane-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[(2-methylpropan-2-yl)oxycarbonylamino]adamantane-2-carboxylic acid (CAS 1411614-11-3) is a chemical compound with the molecular formula C16H25NO4 and a molecular weight of 295.37 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]adamantane-2-carboxylic acid. InChIKey: IOLMNXQFNQSBCA-UHFFFAOYSA-N.
| Molecular formula | C16H25NO4 |
|---|---|
| Molecular weight | 295.37 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]adamantane-2-carboxylic acid |
| InChIKey | IOLMNXQFNQSBCA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(C2CC3CC(C2)CC1C3)C(=O)O |
Computed by PubChem (NCBI)