CAS 1411650-70-8 is the registry number for 2-(3-(3-Chlorophenyl)-2,4-dioxoimidazolidin-1-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[3-(3-chlorophenyl)-2,4-dioxoimidazolidin-1-yl]acetic acid (CAS 1411650-70-8) is a chemical compound with the molecular formula C11H9ClN2O4 and a molecular weight of 268.65 g/mol. IUPAC name: 2-[3-(3-chlorophenyl)-2,4-dioxoimidazolidin-1-yl]acetic acid. InChIKey: AWLXSNKKTDEDHJ-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2O4 |
|---|---|
| Molecular weight | 268.65 g/mol |
| IUPAC name | 2-[3-(3-chlorophenyl)-2,4-dioxoimidazolidin-1-yl]acetic acid |
| InChIKey | AWLXSNKKTDEDHJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=O)N1CC(=O)O)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)