CAS 141184-34-1 appears in our catalog under these names: Filaminast/ 99.64% (existing batch purity), Filaminast, 98%, 98%, Filaminast. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
[(E)-1-(3-cyclopentyloxy-4-methoxyphenyl)ethylideneamino] carbamate (CAS 141184-34-1) is a chemical compound with the molecular formula C15H20N2O4 and a molecular weight of 292.33 g/mol. IUPAC name: [(E)-1-(3-cyclopentyloxy-4-methoxyphenyl)ethylideneamino] carbamate. InChIKey: STTRYQAGHGJXJJ-LICLKQGHSA-N.
| Molecular formula | C15H20N2O4 |
|---|---|
| Molecular weight | 292.33 g/mol |
| IUPAC name | [(E)-1-(3-cyclopentyloxy-4-methoxyphenyl)ethylideneamino] carbamate |
| InChIKey | STTRYQAGHGJXJJ-LICLKQGHSA-N |
| SMILES | C/C(=N\OC(=O)N)/C1=CC(=C(C=C1)OC)OC2CCCC2 |
Computed by PubChem (NCBI)