CAS 141206-22-6 is the registry number for N-Methyl Deoxygalactonojirimycin, >95% (HPLC). Offered by: TRC. Available pack sizes: 1mg, 2mg, 5mg.
(2R,3S,4R,5S)-2-(hydroxymethyl)-1-methylpiperidine-3,4,5-triol (CAS 141206-22-6) is a chemical compound with the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. IUPAC name: (2R,3S,4R,5S)-2-(hydroxymethyl)-1-methylpiperidine-3,4,5-triol. InChIKey: AAKDPDFZMNYDLR-JRTVQGFMSA-N.
| Molecular formula | C7H15NO4 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (2R,3S,4R,5S)-2-(hydroxymethyl)-1-methylpiperidine-3,4,5-triol |
| InChIKey | AAKDPDFZMNYDLR-JRTVQGFMSA-N |
| SMILES | CN1C[C@@H]([C@H]([C@H]([C@H]1CO)O)O)O |
Computed by PubChem (NCBI)