Products 29914-71-4
CAS 29914-71-4 is the registry number for Garamine Impurity 1. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,3R,4R)-2,4,5-trihydroxy-4-methyl-3-(methylamino)pentanal (CAS 29914-71-4) is a chemical compound with the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. IUPAC name: (2R,3R,4R)-2,4,5-trihydroxy-4-methyl-3-(methylamino)pentanal. InChIKey: ZVOVZGHNLQQHGG-XVMARJQXSA-N.
| Molecular formula | C7H15NO4 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (2R,3R,4R)-2,4,5-trihydroxy-4-methyl-3-(methylamino)pentanal |
| InChIKey | ZVOVZGHNLQQHGG-XVMARJQXSA-N |
| SMILES | C[C@](CO)([C@@H]([C@H](C=O)O)NC)O |
Computed by PubChem (NCBI)