CAS 2244622-23-7 is the registry number for (2R,3S,4R,5R)-2-((S)-1-Aminoethyl)-5-methoxytetrahydrofuran-3,4-diol, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(2R,3S,4R,5R)-2-[(1S)-1-aminoethyl]-5-methoxyoxolane-3,4-diol (CAS 2244622-23-7) is a chemical compound with the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. IUPAC name: (2R,3S,4R,5R)-2-[(1S)-1-aminoethyl]-5-methoxyoxolane-3,4-diol. InChIKey: OQMGRVFSMWORIA-PAMBMQIZSA-N.
| Molecular formula | C7H15NO4 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-[(1S)-1-aminoethyl]-5-methoxyoxolane-3,4-diol |
| InChIKey | OQMGRVFSMWORIA-PAMBMQIZSA-N |
| SMILES | C[C@@H]([C@@H]1[C@H]([C@H]([C@@H](O1)OC)O)O)N |
Computed by PubChem (NCBI)