Products 914941-96-1

CAS 914941-96-1 is the registry number for Atorvastatin impurity 107. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-amino-3,5-dihydroxyheptanoic acid (CAS 914941-96-1) is a chemical compound with the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. IUPAC name: 7-amino-3,5-dihydroxyheptanoic acid. InChIKey: XAPGSJPBBUEOEQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15NO4
Molecular weight177.20 g/mol
IUPAC name7-amino-3,5-dihydroxyheptanoic acid
InChIKeyXAPGSJPBBUEOEQ-UHFFFAOYSA-N
SMILESC(CN)C(CC(CC(=O)O)O)O

Computed by PubChem (NCBI)