CAS 141299-96-9 appears in our catalog under these names: Altrenogest Impurity 1, 11,12-Dihydro Altrenogest, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(8S,13S,14S,17R)-17-hydroxy-13-methyl-17-prop-2-enyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (CAS 141299-96-9) is a chemical compound with the molecular formula C21H28O2 and a molecular weight of 312.4 g/mol. IUPAC name: (8S,13S,14S,17R)-17-hydroxy-13-methyl-17-prop-2-enyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one. InChIKey: LBMSACRATXETPF-ANULTFPQSA-N.
| Molecular formula | C21H28O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (8S,13S,14S,17R)-17-hydroxy-13-methyl-17-prop-2-enyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | LBMSACRATXETPF-ANULTFPQSA-N |
| SMILES | C[C@]12CCC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@]2(CC=C)O |
Computed by PubChem (NCBI)