CAS 141305-40-0 appears in our catalog under these names: 4-Bromo-2-phenylthiazole, 98%, 4-Bromo-2-phenylthiazole, 4-Bromo-2-phenylthiazole 97%, 4-Bromo-2-phenylthiazole, 97%, 97%, 4-Bromo-2-phenylthiazole, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g.
4-bromo-2-phenyl-1,3-thiazole (CAS 141305-40-0) is a chemical compound with the molecular formula C9H6BrNS and a molecular weight of 240.12 g/mol. IUPAC name: 4-bromo-2-phenyl-1,3-thiazole. InChIKey: XGBWZNGTYRKKFE-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNS |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 4-bromo-2-phenyl-1,3-thiazole |
| InChIKey | XGBWZNGTYRKKFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)Br |
Computed by PubChem (NCBI)