CAS 20738-25-4 is the registry number for 7-Bromoquinoline-8-thiol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromoquinoline-8-thiol (CAS 20738-25-4) is a chemical compound with the molecular formula C9H6BrNS and a molecular weight of 240.12 g/mol. IUPAC name: 7-bromoquinoline-8-thiol. InChIKey: ZIPUIRKPZYIHLV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNS |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 7-bromoquinoline-8-thiol |
| InChIKey | ZIPUIRKPZYIHLV-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)Br)S)N=C1 |
Computed by PubChem (NCBI)