CAS 30216-49-0 appears in our catalog under these names: 4-(2-Bromophenyl)-1,3-thiazole, 95%, 4-(2-Bromophenyl)-1,3-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(2-bromophenyl)-1,3-thiazole (CAS 30216-49-0) is a chemical compound with the molecular formula C9H6BrNS and a molecular weight of 240.12 g/mol. IUPAC name: 4-(2-bromophenyl)-1,3-thiazole. InChIKey: ZFMNKQKZWGAYGX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNS |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 4-(2-bromophenyl)-1,3-thiazole |
| InChIKey | ZFMNKQKZWGAYGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CSC=N2)Br |
Computed by PubChem (NCBI)