CAS 30216-47-8 appears in our catalog under these names: 2-(3-Bromophenyl)thiazole, 95+%, 2-(3-Bromophenyl)-1,3-thiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-(3-bromophenyl)-1,3-thiazole (CAS 30216-47-8) is a chemical compound with the molecular formula C9H6BrNS and a molecular weight of 240.12 g/mol. IUPAC name: 2-(3-bromophenyl)-1,3-thiazole. InChIKey: BETBCTULGKILCZ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNS |
|---|---|
| Molecular weight | 240.12 g/mol |
| IUPAC name | 2-(3-bromophenyl)-1,3-thiazole |
| InChIKey | BETBCTULGKILCZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C2=NC=CS2 |
Computed by PubChem (NCBI)