Products 14131-63-6
CAS 14131-63-6 is the registry number for (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol hydrochloride, 98%. Offered by: Chemat. Available pack sizes: 25g, 100g, 250g, 1kg.
(2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride (CAS 14131-63-6) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride. InChIKey: QKPLRMLTKYXDST-OCOFDJSDSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2R,3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;hydrochloride |
| InChIKey | QKPLRMLTKYXDST-OCOFDJSDSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O)N)O)O)O.Cl |
Computed by PubChem (NCBI)