Products 141333-82-6
CAS 141333-82-6 is the registry number for 5-(2,5-Dimethylphenoxymethyl)-1,3,4-oxadiazole-2-thiol. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
5-[(2,5-dimethylphenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione (CAS 141333-82-6) is a chemical compound with the molecular formula C11H12N2O2S and a molecular weight of 236.29 g/mol. IUPAC name: 5-[(2,5-dimethylphenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione. InChIKey: ZJTKSHOMWRHRSJ-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | 5-[(2,5-dimethylphenoxy)methyl]-3H-1,3,4-oxadiazole-2-thione |
| InChIKey | ZJTKSHOMWRHRSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)OCC2=NNC(=S)O2 |
Computed by PubChem (NCBI)