CAS 141363-91-9 is the registry number for Lanomycin. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-methoxy-5-methyl-2-[(2E,4E,6E)-octa-2,4,6-trien-2-yl]oxan-3-yl] 2-aminoacetate (CAS 141363-91-9) is a chemical compound with the molecular formula C17H27NO4 and a molecular weight of 309.4 g/mol. IUPAC name: [4-methoxy-5-methyl-2-[(2E,4E,6E)-octa-2,4,6-trien-2-yl]oxan-3-yl] 2-aminoacetate. InChIKey: DMLQRXAYJODTLF-XXDOZSIZSA-N.
| Molecular formula | C17H27NO4 |
|---|---|
| Molecular weight | 309.4 g/mol |
| IUPAC name | [4-methoxy-5-methyl-2-[(2E,4E,6E)-octa-2,4,6-trien-2-yl]oxan-3-yl] 2-aminoacetate |
| InChIKey | DMLQRXAYJODTLF-XXDOZSIZSA-N |
| SMILES | C/C=C/C=C/C=C(\C)/C1C(C(C(CO1)C)OC)OC(=O)CN |
Computed by PubChem (NCBI)