Products 1414029-44-9
CAS 1414029-44-9 is the registry number for 2,5-Di-tert-butyl pyridine-2,5-dicarboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ditert-butyl pyridine-2,5-dicarboxylate (CAS 1414029-44-9) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: ditert-butyl pyridine-2,5-dicarboxylate. InChIKey: AYIYUIXJNHFKNJ-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | ditert-butyl pyridine-2,5-dicarboxylate |
| InChIKey | AYIYUIXJNHFKNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN=C(C=C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)