Products 1414029-55-2
CAS 1414029-55-2 is the registry number for Methyl 1-tert-butyl-2-methyl-1,3-benzodiazole-5-carboxylate, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
Methyl 1-tert-butyl-2-methylbenzimidazole-5-carboxylate (CAS 1414029-55-2) is a chemical compound with the molecular formula C14H18N2O2 and a molecular weight of 246.30 g/mol. IUPAC name: methyl 1-tert-butyl-2-methylbenzimidazole-5-carboxylate. InChIKey: RGHLNYMCIDPRRB-UHFFFAOYSA-N.
| Molecular formula | C14H18N2O2 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | methyl 1-tert-butyl-2-methylbenzimidazole-5-carboxylate |
| InChIKey | RGHLNYMCIDPRRB-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C(C)(C)C)C=CC(=C2)C(=O)OC |
Computed by PubChem (NCBI)