CAS 141412-60-4 appears in our catalog under these names: 2,5–Difluoro–4–nitrotoluene, 2,5-Difluoro-4-nitrotoluene, >98.0%(GC), 1,4-Difluoro-2-methyl-5-nitrobenzene 97%, 1,4-Difluoro-2-methyl-5-nitrobenzene 98%, 1,4-Difluoro-2-methyl-5-nitrobenzene, 98%. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 1g, 5g, 250mg, 10g, 500g.
1,4-difluoro-2-methyl-5-nitrobenzene (CAS 141412-60-4) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 1,4-difluoro-2-methyl-5-nitrobenzene. InChIKey: ABWWQMGGJXKGBL-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 1,4-difluoro-2-methyl-5-nitrobenzene |
| InChIKey | ABWWQMGGJXKGBL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)