CAS 1414843-61-0 is the registry number for VU 0465350. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
7-(4-propan-2-yloxyphenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridine (CAS 1414843-61-0) is a chemical compound with the molecular formula C19H18N4O and a molecular weight of 318.4 g/mol. IUPAC name: 7-(4-propan-2-yloxyphenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridine. InChIKey: CJFSBECQAATXRD-UHFFFAOYSA-N.
| Molecular formula | C19H18N4O |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 7-(4-propan-2-yloxyphenyl)-3-(1H-pyrazol-4-yl)imidazo[1,2-a]pyridine |
| InChIKey | CJFSBECQAATXRD-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)C2=CC3=NC=C(N3C=C2)C4=CNN=C4 |
Computed by PubChem (NCBI)