CAS 2624098-97-9 is the registry number for MU1787. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-tert-butylphenyl)-5-(2H-triazol-4-yl)furo[3,2-b]pyridine (CAS 2624098-97-9) is a chemical compound with the molecular formula C19H18N4O and a molecular weight of 318.4 g/mol. IUPAC name: 3-(4-tert-butylphenyl)-5-(2H-triazol-4-yl)furo[3,2-b]pyridine. InChIKey: KTGZHJWTKLQHBK-UHFFFAOYSA-N.
| Molecular formula | C19H18N4O |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 3-(4-tert-butylphenyl)-5-(2H-triazol-4-yl)furo[3,2-b]pyridine |
| InChIKey | KTGZHJWTKLQHBK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=COC3=C2N=C(C=C3)C4=NNN=C4 |
Computed by PubChem (NCBI)