CAS 1453097-13-6 appears in our catalog under these names: HUHS 015, HUHS015/ 99.81% (existing batch purity), HUHS015, HUHS015, 99.32%, HUHS015 (Standard). Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 250mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg.
4-benzyl-5-methyl-2-(6-methyl-1H-benzimidazol-2-yl)-1H-pyrazol-3-one (CAS 1453097-13-6) is a chemical compound with the molecular formula C19H18N4O and a molecular weight of 318.4 g/mol. IUPAC name: 4-benzyl-5-methyl-2-(6-methyl-1H-benzimidazol-2-yl)-1H-pyrazol-3-one. InChIKey: IQOKQFQFGHZHJT-UHFFFAOYSA-N.
| Molecular formula | C19H18N4O |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 4-benzyl-5-methyl-2-(6-methyl-1H-benzimidazol-2-yl)-1H-pyrazol-3-one |
| InChIKey | IQOKQFQFGHZHJT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)N3C(=O)C(=C(N3)C)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)