CAS 903632-51-9 is the registry number for N'-(4-(Dimethylamino)benzylidene)quinoline-3-carbohydrazide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]quinoline-3-carboxamide (CAS 903632-51-9) is a chemical compound with the molecular formula C19H18N4O and a molecular weight of 318.4 g/mol. IUPAC name: N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]quinoline-3-carboxamide. InChIKey: GCGOWNLWEBLUMU-CIAFOILYSA-N.
| Molecular formula | C19H18N4O |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]quinoline-3-carboxamide |
| InChIKey | GCGOWNLWEBLUMU-CIAFOILYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)/C=N/NC(=O)C2=CC3=CC=CC=C3N=C2 |
Computed by PubChem (NCBI)