Products 1414891-50-1
CAS 1414891-50-1 is the registry number for N3-L-Lys(Z)-OH*DCHA. Offered by: Iris Biotech. Available pack sizes: 1g, 5g, 25g.
(2S)-2-azido-6-(phenylmethoxycarbonylamino)hexanoic acid (CAS 1414891-50-1) is a chemical compound with the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. IUPAC name: (2S)-2-azido-6-(phenylmethoxycarbonylamino)hexanoic acid. InChIKey: FESBFPKSUVQDKY-LBPRGKRZSA-N.
| Molecular formula | C14H18N4O4 |
|---|---|
| Molecular weight | 306.32 g/mol |
| IUPAC name | (2S)-2-azido-6-(phenylmethoxycarbonylamino)hexanoic acid |
| InChIKey | FESBFPKSUVQDKY-LBPRGKRZSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCCC[C@@H](C(=O)O)N=[N+]=[N-] |
Computed by PubChem (NCBI)