CAS 27653-67-4 appears in our catalog under these names: Trimethoprim Impurity 6, Trimethoprim 3-N-Oxide, >95% (HPLC), Trimethoprim 3–oxide, Trimethoprim 3-N-oxide, Trimethoprim 3-oxide, 98.0%. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 10 mg, 5 mg.
3-hydroxy-2-imino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-amine (CAS 27653-67-4) is a chemical compound with the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. IUPAC name: 3-hydroxy-2-imino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-amine. InChIKey: YQVPBGLBUGARPD-UHFFFAOYSA-N.
| Molecular formula | C14H18N4O4 |
|---|---|
| Molecular weight | 306.32 g/mol |
| IUPAC name | 3-hydroxy-2-imino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-amine |
| InChIKey | YQVPBGLBUGARPD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)CC2=C(N(C(=N)N=C2)O)N |
Computed by PubChem (NCBI)