CAS 214630-05-4 appears in our catalog under these names: Boc-D-Phe(4-N3)-OH, Boc–p–azido–D–Phe–OH. Offered by: Iris Biotech, GLPBio. Available pack sizes: 1g, 5g, 25g, 250mg, 500mg.
(2R)-3-(4-azidophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 214630-05-4) is a chemical compound with the molecular formula C14H18N4O4 and a molecular weight of 306.32 g/mol. IUPAC name: (2R)-3-(4-azidophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PZWGGRIVPTXYGU-LLVKDONJSA-N.
| Molecular formula | C14H18N4O4 |
|---|---|
| Molecular weight | 306.32 g/mol |
| IUPAC name | (2R)-3-(4-azidophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PZWGGRIVPTXYGU-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)N=[N+]=[N-])C(=O)O |
Computed by PubChem (NCBI)