Products 1794752-40-1
CAS 1794752-40-1 is the registry number for 4-Hydroxy Trimethoprim-d9. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
2,4-diamino-5-[[3,4,5-tris(trideuteriomethoxy)phenyl]methyl]-1H-pyrimidin-6-one (CAS 1794752-40-1) is a chemical compound with the molecular formula C14H18N4O4 and a molecular weight of 315.37 g/mol. IUPAC name: 2,4-diamino-5-[[3,4,5-tris(trideuteriomethoxy)phenyl]methyl]-1H-pyrimidin-6-one. InChIKey: FYJKTYLNKCUCLP-GQALSZNTSA-N.
| Molecular formula | C14H18N4O4 |
|---|---|
| Molecular weight | 315.37 g/mol |
| IUPAC name | 2,4-diamino-5-[[3,4,5-tris(trideuteriomethoxy)phenyl]methyl]-1H-pyrimidin-6-one |
| InChIKey | FYJKTYLNKCUCLP-GQALSZNTSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC(=CC(=C1OC([2H])([2H])[2H])OC([2H])([2H])[2H])CC2=C(N=C(NC2=O)N)N |
Computed by PubChem (NCBI)
Synonyms:
4-Hydroxy Trimethoprim-d9