CAS 1414958-76-1 is the registry number for 5-(5-Chlorothiophen-2-yl)-4-ethyl-1,2-oxazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(5-chlorothiophen-2-yl)-4-ethyl-1,2-oxazol-3-amine (CAS 1414958-76-1) is a chemical compound with the molecular formula C9H9ClN2OS and a molecular weight of 228.70 g/mol. IUPAC name: 5-(5-chlorothiophen-2-yl)-4-ethyl-1,2-oxazol-3-amine. InChIKey: IOOWFGHLAUOHNE-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2OS |
|---|---|
| Molecular weight | 228.70 g/mol |
| IUPAC name | 5-(5-chlorothiophen-2-yl)-4-ethyl-1,2-oxazol-3-amine |
| InChIKey | IOOWFGHLAUOHNE-UHFFFAOYSA-N |
| SMILES | CCC1=C(ON=C1N)C2=CC=C(S2)Cl |
Computed by PubChem (NCBI)